ChemNet > CAS > 5735-41-1 2-(Hydroxymethyl)benzeneboronic acid cyclic monoester
5735-41-1 2-(Hydroxymethyl)benzeneboronic acid cyclic monoester
| 상품명칭 |
2-(Hydroxymethyl)benzeneboronic acid cyclic monoester |
| 영문 이름 |
2-(Hydroxymethyl)benzeneboronic acid cyclic monoester; 1-Hydroxy-2,1-benzoxaborolane~2-(Hydroxymethyl)phenylboronic acid cyclic monoester; 2-(Hydroxymethyl)phenylboronic acid cyclic monoester; 2,1-benzoxaborol-1(3H)-ol; [2-(hydroxymethyl)phenyl]boronic acid |
| 분자식 |
C7H9BO3 |
| 분자량 |
151.9556 |
| InChI |
InChI=1/C7H9BO3/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4,9-11H,5H2 |
| cas번호 |
5735-41-1 |
| 분자 구조 |
|
| 밀도 |
1.25g/cm3 |
| 녹는 점 |
95-100℃ |
| 비등점 |
379.8°C at 760 mmHg |
| 굴절 지수 |
1.566 |
| 인화점 |
183.5°C |
| 증기압 |
1.92E-06mmHg at 25°C |
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|