ChemNet > CAS > 57455-06-8 3-Iodobenzyl alcohol
57455-06-8 3-Iodobenzyl alcohol
| 상품명칭 |
3-Iodobenzyl alcohol |
| 영문 이름 |
3-Iodobenzyl alcohol; Benzyl alcohol, m-iodo-; BRN 3234821; Benzenemethanol, 3-iodo-; m-Iodobenzyl alcohol; (3-iodophenyl)methanol |
| 분자식 |
C7H7IO |
| 분자량 |
234.0343 |
| InChI |
InChI=1/C7H7IO/c8-7-3-1-2-6(4-7)5-9/h1-4,9H,5H2 |
| cas번호 |
57455-06-8 |
| EC번호 |
260-744-9 |
| 분자 구조 |
|
| 밀도 |
1.867g/cm3 |
| 비등점 |
254.7°C at 760 mmHg |
| 굴절 지수 |
1.648 |
| 인화점 |
129.8°C |
| 증기압 |
0.00881mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
