5751-82-6 Ethyl 5-chlorothiophene-2-carboxylate

상품명칭	Ethyl 5-chlorothiophene-2-carboxylate
영문 이름	Ethyl 5-chlorothiophene-2-carboxylate; 5-Chlorothiophene-2-carboxylic acid ethyl ester; Ethyl 5-chlorothiophene-2-carboxlate;
분자식	C₇H₇ClO₂S
분자량	190.6473
InChI	InChI=1/C7H7ClO2S/c1-2-10-7(9)5-3-4-6(8)11-5/h3-4H,2H2,1H3
cas번호	5751-82-6
분자 구조
밀도	1.312g/cm³
비등점	253.7°C at 760 mmHg
굴절 지수	1.545
인화점	107.3°C
증기압	0.018mmHg at 25°C
위험성 표시
리스크 규칙	R36/38:Irritating to eyes and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;