5781-53-3 Methyl oxalyl chloride
상품명칭 |
Methyl oxalyl chloride |
영문 이름 |
Methyl oxalyl chloride; Methyl chloroglyoxylate; Monomethyl oxalyl chloride; methyl chlorooxoacetate; Chloroglyoxylic acid methyl ester |
분자식 |
C3H3ClO3 |
분자량 |
122.5071 |
InChI |
InChI=1/C3H3ClO3/c1-7-3(6)2(4)5/h1H3 |
cas번호 |
5781-53-3 |
EC번호 |
227-307-4 |
분자 구조 |
|
밀도 |
1.36g/cm3 |
비등점 |
119°C at 760 mmHg |
굴절 지수 |
1.416 |
인화점 |
46.7°C |
증기압 |
16.3mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R10:Flammable.;
R34:Causes burns.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S28A:After contact with skin, wash immediately with plenty of water.;
S9:Keep container in a well-ventilated place.;
|
|