ChemNet > CAS > 57915-78-3 2,3-dichlorobenzyl bromide
57915-78-3 2,3-dichlorobenzyl bromide
상품명칭 |
2,3-dichlorobenzyl bromide |
영문 이름 |
2,3-dichlorobenzyl bromide;1-(bromomethyl)-2,3-dichlorobenzene |
분자식 |
C7H5BrCl2 |
분자량 |
239.9246 |
InChI |
InChI=1/C7H5BrCl2/c8-4-5-2-1-3-6(9)7(5)10/h1-3H,4H2 |
cas번호 |
57915-78-3 |
분자 구조 |
|
밀도 |
1.679g/cm3 |
녹는 점 |
38℃ |
비등점 |
263.3°C at 760 mmHg |
굴절 지수 |
1.597 |
인화점 |
127.3°C |
증기압 |
0.0169mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|