5820-22-4 Methallyl phenyl ether
상품명칭 |
Methallyl phenyl ether |
영문 이름 |
Methallyl phenyl ether; 2-Methyl-2-propenyl phenyl ether; p-Methallyl chlorobenzene; [(2-methylprop-2-en-1-yl)oxy]benzene |
분자식 |
C10H12O |
분자량 |
148.2017 |
InChI |
InChI=1/C10H12O/c1-9(2)8-11-10-6-4-3-5-7-10/h3-7H,1,8H2,2H3 |
cas번호 |
5820-22-4 |
EC번호 |
227-393-3 |
분자 구조 |
|
밀도 |
0.938g/cm3 |
비등점 |
175.5°C at 760 mmHg |
굴절 지수 |
1.499 |
인화점 |
77°C |
증기압 |
1.54mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42/43:May cause sensitization by inhalation and skin contact.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|