ChemNet > CAS > 583-59-5 2-Methylcyclohexanol
583-59-5 2-Methylcyclohexanol
| 상품명칭 |
2-Methylcyclohexanol |
| 영문 이름 |
2-Methylcyclohexanol; 2-Methylcyclohexanol, mixture of cis and trans; 2-Methylcyclohexyl alcohol; (1R,2R)-2-methylcyclohexanol; (1R,2S)-2-methylcyclohexanol; (1S,2S)-2-methylcyclohexanol; (1S,2R)-2-methylcyclohexanol; O-methylcyclohexl alcohol; 2-metilcicloesanone |
| 분자식 |
C7H14O |
| 분자량 |
114.1855 |
| InChI |
InChI=1/C7H14O/c1-6-4-2-3-5-7(6)8/h6-8H,2-5H2,1H3/t6-,7+/m1/s1 |
| cas번호 |
583-59-5 |
| EC번호 |
209-512-0 |
| 분자 구조 |
|
| 밀도 |
0.925g/cm3 |
| 녹는 점 |
-38℃ |
| 비등점 |
170.3°C at 760 mmHg |
| 굴절 지수 |
1.462 |
| 인화점 |
58.9°C |
| 물 용해도 |
slightly soluble |
| 증기압 |
0.475mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20:;
|
| 보안 규칙 |
S24/25:;
|
|
