ChemNet > CAS > 5866-98-8 2,6-Dichloro-3-nitrobenzonitrile
5866-98-8 2,6-Dichloro-3-nitrobenzonitrile
상품명칭 |
2,6-Dichloro-3-nitrobenzonitrile |
영문 이름 |
2,6-Dichloro-3-nitrobenzonitrile; |
분자식 |
C7H2Cl2N2O2 |
분자량 |
217.009 |
InChI |
InChI=1/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H |
cas번호 |
5866-98-8 |
분자 구조 |
|
밀도 |
1.61g/cm3 |
비등점 |
341.7°C at 760 mmHg |
굴절 지수 |
1.615 |
인화점 |
160.5°C |
증기압 |
7.9E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|