587-02-0 3-Ethylaniline
상품명칭 |
3-Ethylaniline |
영문 이름 |
3-Ethylaniline;3-Ethylbenzenamine; 3-Ethylphenylamine; 4-12-00-02417 (Beilstein Handbook Reference); BRN 0636282; m-Ethylaniline; Aniline, m-ethyl-; Benzenamine, 3-ethyl- (9CI) |
분자식 |
C8H11N |
분자량 |
121.1796 |
InChI |
InChI=1/C8H11N/c1-2-7-4-3-5-8(9)6-7/h3-6H,2,9H2,1H3 |
cas번호 |
587-02-0 |
EC번호 |
209-594-8 |
분자 구조 |
|
밀도 |
0.973g/cm3 |
녹는 점 |
-8℃ |
비등점 |
216.6°C at 760 mmHg |
굴절 지수 |
1.556 |
인화점 |
85°C |
증기압 |
0.139mmHg at 25°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
보안 규칙 |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|