ChemNet > CAS > 587-90-6 N,N'-Bis-(4-nitrophenyl)urea
587-90-6 N,N'-Bis-(4-nitrophenyl)urea
상품명칭 |
N,N'-Bis-(4-nitrophenyl)urea |
영문 이름 |
N,N'-Bis-(4-nitrophenyl)urea; 1,3-Bis(4-nitrophenyl)urea; 4,4-Dinitrocarbanilide |
분자식 |
C13H10N4O5 |
분자량 |
302.2423 |
InChI |
InChI=1/C13H10N4O5/c18-13(14-9-1-5-11(6-2-9)16(19)20)15-10-3-7-12(8-4-10)17(21)22/h1-8H,(H2,14,15,18) |
cas번호 |
587-90-6 |
EC번호 |
209-607-7 |
분자 구조 |
|
밀도 |
1.561g/cm3 |
비등점 |
414.8°C at 760 mmHg |
굴절 지수 |
1.741 |
인화점 |
204.7°C |
증기압 |
4.32E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|