588-43-2 tributyl orthoformate
상품명칭 |
tributyl orthoformate |
영문 이름 |
tributyl orthoformate; 1-(Dibutoxymethoxy)butane; 1,1',1''-(Methylidynetris(oxy))tributane; Butane, 1,1',1''-(methylidynetris(oxy))tris-; butane, 1,1',1''-[methylidynetris(oxy)]tris-; Orthoformic acid, tributyl ester; Orthoformic acid, tributyl ester (8CI) |
분자식 |
C13H28O3 |
분자량 |
232.3596 |
InChI |
InChI=1/C13H28O3/c1-4-7-10-14-13(15-11-8-5-2)16-12-9-6-3/h13H,4-12H2,1-3H3 |
cas번호 |
588-43-2 |
EC번호 |
209-618-7 |
분자 구조 |
|
밀도 |
0.884g/cm3 |
비등점 |
262.7°C at 760 mmHg |
굴절 지수 |
1.427 |
인화점 |
96.3°C |
증기압 |
0.0175mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|