ChemNet > CAS > 58880-37-8 1-(4-Chlorophenyl)-1-cyclohexanecarboxylicacid
58880-37-8 1-(4-Chlorophenyl)-1-cyclohexanecarboxylicacid
상품명칭 |
1-(4-Chlorophenyl)-1-cyclohexanecarboxylicacid |
영문 이름 |
1-(4-Chlorophenyl)-1-cyclohexanecarboxylicacid; 1-(4-Chlorophenyl)cyclohexane-1-carboxylic acid; 1-(4-chlorophenyl)cyclohexanecarboxylic acid; 1-(4-chlorophenyl)cyclohexanecarboxylate |
분자식 |
C13H14ClO2 |
분자량 |
237.7026 |
InChI |
InChI=1/C13H15ClO2/c14-11-6-4-10(5-7-11)13(12(15)16)8-2-1-3-9-13/h4-7H,1-3,8-9H2,(H,15,16)/p-1 |
cas번호 |
58880-37-8 |
EC번호 |
261-481-2 |
분자 구조 |
|
녹는 점 |
150-156℃ |
비등점 |
378.9°C at 760 mmHg |
인화점 |
183°C |
증기압 |
2.04E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|