ChemNet > CAS > 589-55-9 4-Heptanol
589-55-9 4-Heptanol
| 상품명칭 |
4-Heptanol |
| 영문 이름 |
4-Heptanol; Dipropylcarbinol; heptan-4-ol |
| 분자식 |
C7H16O |
| 분자량 |
116.2013 |
| InChI |
InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
| cas번호 |
589-55-9 |
| EC번호 |
209-651-7 |
| 분자 구조 |
|
| 밀도 |
0.818g/cm3 |
| 비등점 |
161.3°C at 760 mmHg |
| 굴절 지수 |
1.42 |
| 인화점 |
61.8°C |
| 증기압 |
0.792mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R10:Flammable.;
R36:Irritating to eyes.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|
