58971-11-2 3-Bromophenethylamine
상품명칭 |
3-Bromophenethylamine |
영문 이름 |
3-Bromophenethylamine;2-(3-bromophenyl)ethanaminium; 2-(3-bromophenyl)ethanamine; 3-Bromo-benzeneethanamine |
분자식 |
C8H10BrN |
분자량 |
200.0757 |
InChI |
InChI=1/C8H10BrN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2 |
cas번호 |
58971-11-2 |
분자 구조 |
|
밀도 |
1.407g/cm3 |
비등점 |
263.4°C at 760 mmHg |
굴절 지수 |
1.575 |
인화점 |
113.1°C |
증기압 |
0.0103mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|