ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
| 상품명칭 |
4-(difluoromethoxy)bromobenzene |
| 영문 이름 |
4-(difluoromethoxy)bromobenzene; 1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
| 분자식 |
C7H5BrF2O |
| 분자량 |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
| cas번호 |
5905-69-1 |
| 분자 구조 |
|
| 밀도 |
1.583g/cm3 |
| 비등점 |
205.406°C at 760 mmHg |
| 굴절 지수 |
1.492 |
| 인화점 |
92.591°C |
| 증기압 |
0.359mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
