ChemNet > CAS > 591-82-2 Isobutyl isothiocyanate
591-82-2 Isobutyl isothiocyanate
| 상품명칭 |
Isobutyl isothiocyanate |
| 영문 이름 |
Isobutyl isothiocyanate; Isothiocyanic acid, isobutyl ester; 1-Isothiocyanato-2-methylpropane; 2-Methylpropyl isothiocyanate; 4-04-00-00653 (Beilstein Handbook Reference); BRN 1740371; EINECS 209-733-2; i-Butyl isothiocyanate; Propane, 1-isothiocyanato-2-methyl- |
| 분자식 |
C5H9NS |
| 분자량 |
115.1967 |
| InChI |
InChI=1/C5H9NS/c1-5(2)3-6-4-7/h5H,3H2,1-2H3 |
| cas번호 |
591-82-2 |
| EC번호 |
209-733-2 |
| 분자 구조 |
|
| 밀도 |
0.92g/cm3 |
| 비등점 |
163.3°C at 760 mmHg |
| 굴절 지수 |
1.485 |
| 인화점 |
44.2°C |
| 증기압 |
2.72mmHg at 25°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
