59463-56-8 시아노메틸 에탄티오에이트
상품명칭 |
시아노메틸 에탄티오에이트 |
별명 |
S-(시아노메틸)에탄티오에이트 |
영문 이름 |
cyanomethyl ethanethioate;S-(cyanomethyl) ethanethioate |
분자식 |
C4H5NOS |
분자량 |
115.1536 |
InChI |
InChI=1/C4H5NOS/c1-4(6)7-3-2-5/h3H2,1H3 |
cas번호 |
59463-56-8 |
분자 구조 |
|
밀도 |
1.162g/cm3 |
비등점 |
198.1°C at 760 mmHg |
굴절 지수 |
1.487 |
인화점 |
73.6°C |
증기압 |
0.367mmHg at 25°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|