5965-53-7 Diethyl oxalpropionate
상품명칭 |
Diethyl oxalpropionate |
영문 이름 |
Diethyl oxalpropionate; Diethyl 2-methyl-2-oxosuccinate; Diethyl oxalpropionate;
; diethyl 2-oxopentanedioate; ethyl propyl carbonate |
분자식 |
C6H12O3 |
분자량 |
132.1577 |
InChI |
InChI=1/C6H12O3/c1-3-5-9-6(7)8-4-2/h3-5H2,1-2H3 |
cas번호 |
5965-53-7 |
EC번호 |
227-750-3 |
분자 구조 |
|
밀도 |
0.961g/cm3 |
비등점 |
139.3°C at 760 mmHg |
굴절 지수 |
1.4 |
인화점 |
48.3°C |
증기압 |
6.46mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|