602-55-1 9-Phenylanthracene
상품명칭 |
9-Phenylanthracene |
영문 이름 |
9-Phenylanthracene; Phenylanthracene; anthracene,9-phenyl-; 9-phenylantracene |
분자식 |
C20H14 |
분자량 |
254.3252 |
InChI |
InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
cas번호 |
602-55-1 |
EC번호 |
210-019-8 |
분자 구조 |
|
밀도 |
1.14g/cm3 |
녹는 점 |
149-153℃ |
비등점 |
417°C at 760 mmHg |
굴절 지수 |
1.703 |
인화점 |
192.1°C |
증기압 |
8.86E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|