603-10-1 2,3,6-trinitrophenol moistened with water (H2O ~40%)

상품명칭	2,3,6-trinitrophenol moistened with water (H2O ~40%)
영문 이름	2,3,6-trinitrophenol moistened with water (H2O ~40%);
분자식	C₆H₃N₃O₇
분자량	229.1039
InChI	InChI=1/C6H3N3O7/c10-6-4(8(13)14)2-1-3(7(11)12)5(6)9(15)16/h1-2,10H
cas번호	603-10-1
분자 구조
밀도	1.856g/cm³
녹는 점	119-120℃
비등점	337.9°C at 760 mmHg
굴절 지수	1.701
인화점	151.1°C
증기압	5.2E-05mmHg at 25°C
위험성 표시
리스크 규칙
보안 규칙