605-02-7 1-Phenylnaphthalene
상품명칭 |
1-Phenylnaphthalene |
영문 이름 |
1-Phenylnaphthalene;NSC 5257; Naphthalene, 1-phenyl-; Naphthalene, 1-phenyl- (8CI)(9CI) |
분자식 |
C16H12 |
분자량 |
204.2665 |
InChI |
InChI=1/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
cas번호 |
605-02-7 |
EC번호 |
210-081-6 |
분자 구조 |
|
밀도 |
1.081g/cm3 |
비등점 |
336.4°C at 760 mmHg |
굴절 지수 |
1.647 |
인화점 |
148.2°C |
증기압 |
0.000219mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|