605-62-9 4-Nitro-1-Naphthol
상품명칭 |
4-Nitro-1-Naphthol |
영문 이름 |
4-Nitro-1-Naphthol; 4-nitronaphthalen-1-ol |
분자식 |
C10H7NO3 |
분자량 |
189.1675 |
InChI |
InChI=1/C10H7NO3/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6,12H |
cas번호 |
605-62-9 |
분자 구조 |
|
밀도 |
1.413g/cm3 |
비등점 |
398.8°C at 760 mmHg |
굴절 지수 |
1.714 |
인화점 |
179.8°C |
증기압 |
6.25E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|