608-28-6 2-Iodo-m-xylene
상품명칭 |
2-Iodo-m-xylene |
영문 이름 |
2-Iodo-m-xylene; 2-Iodo-1,3-Dimethylbenzene |
분자식 |
C8H9I |
분자량 |
232.0615 |
InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
cas번호 |
608-28-6 |
EC번호 |
210-158-4 |
분자 구조 |
|
밀도 |
1.61g/cm3 |
비등점 |
227.5°C at 760 mmHg |
굴절 지수 |
1.592 |
인화점 |
98.1°C |
물 용해도 |
insoluble |
증기압 |
0.116mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|