ChemNet > CAS > 61-47-2 세로토닌 크레아티닌 설페이트 일 수화물
61-47-2 세로토닌 크레아티닌 설페이트 일 수화물
| 상품명칭 |
세로토닌 크레아티닌 설페이트 일 수화물 |
| 별명 |
; 5-하이드록시트립타민 크레아티닌 설페이트 일수화물; 2- (2- 아미노 에틸) 인돌 -5- 올 2- 이미노 -1- 메틸 이미다 졸린 -4- 온 황산염; 2- 아미노 -1- 메틸 -4- 옥소 -4,5- 디 하이드로 -1H- 이미 다졸 -1- 이미 다졸 -1- 이엄 2- (5- 히드 록시 -1H- 인돌 -3- 일) 에탄 아미늄 설페이트 (1 : 1 : 1); 3- (2- 아미노 에틸) -1H- 인돌 -5- 올; 2-아미노-1-메틸-5H-이미다졸-4-온; 황산; 수화물; 2-(5-하이드록시-1H-인돌-3-일)에탄아미늄 |
| 영문 이름 |
Serotonin creatinine sulfate monohydrate; 5-Hydroxytryptamine creatinine sulfate monohydrate; 2-(2-aminoethyl)indole-5-ol 2-imino-1-methylimidazoline-4-one sulphate; 2-amino-1-methyl-4-oxo-4,5-dihydro-1H-imidazol-1-ium 2-(5-hydroxy-1H-indol-3-yl)ethanaminium sulfate (1:1:1); 3-(2-aminoethyl)-1H-indol-5-ol; 2-amino-1-methyl-5H-imidazol-4-one; sulfuric acid; hydrate; 2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| 분자식 |
C10H13N2O |
| 분자량 |
177.2225 |
| InChI |
InChI=1/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1 |
| cas번호 |
61-47-2 |
| EC번호 |
213-539-3 |
| 분자 구조 |
|
| 녹는 점 |
216-219℃ |
| 비등점 |
416.1°C at 760 mmHg |
| 인화점 |
205.4°C |
| 증기압 |
1.63E-07mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R40:Possible risks of irreversible effects.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
