ChemNet > CAS > 610-57-1 2,4-Dinitrobenzyl chloride
610-57-1 2,4-Dinitrobenzyl chloride
상품명칭 |
2,4-Dinitrobenzyl chloride |
영문 이름 |
2,4-Dinitrobenzyl chloride; alpha-Chloro-2,4-dinitrotoluene; 4-(Chloromethyl)-1,3-dinitrobenzene; 1-(chloromethyl)-2,4-dinitrobenzene |
분자식 |
C7H5ClN2O4 |
분자량 |
216.5786 |
InChI |
InChI=1/C7H5ClN2O4/c8-4-5-1-2-6(9(11)12)3-7(5)10(13)14/h1-3H,4H2 |
cas번호 |
610-57-1 |
EC번호 |
210-230-5 |
분자 구조 |
|
밀도 |
1.538g/cm3 |
녹는 점 |
34-36℃ |
비등점 |
349.8°C at 760 mmHg |
굴절 지수 |
1.614 |
인화점 |
165.4°C |
증기압 |
9.24E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|