ChemNet > CAS > 61040-81-1 3,5-Dimethoxy-4-methylbenzoic acid
61040-81-1 3,5-Dimethoxy-4-methylbenzoic acid
상품명칭 |
3,5-Dimethoxy-4-methylbenzoic acid |
영문 이름 |
3,5-Dimethoxy-4-methylbenzoic acid; 3,5-Dimethoxy-p-toluic acid (COOH=1) |
분자식 |
C10H12O4 |
분자량 |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6-8(13-2)4-7(10(11)12)5-9(6)14-3/h4-5H,1-3H3,(H,11,12) |
cas번호 |
61040-81-1 |
분자 구조 |
|
밀도 |
1.18g/cm3 |
녹는 점 |
211-216℃ |
비등점 |
347.7°C at 760 mmHg |
굴절 지수 |
1.53 |
인화점 |
137.8°C |
증기압 |
1.99E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|