611-79-0 3,3'-Diaminobenzophenone
상품명칭 |
3,3'-Diaminobenzophenone |
영문 이름 |
3,3'-Diaminobenzophenone; bis(3-aminophenyl)methanone |
분자식 |
C13H12N2O |
분자량 |
212.2472 |
InChI |
InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
cas번호 |
611-79-0 |
EC번호 |
210-281-3 |
분자 구조 |
|
밀도 |
1.233g/cm3 |
비등점 |
469.4°C at 760 mmHg |
굴절 지수 |
1.673 |
인화점 |
237.7°C |
증기압 |
5.51E-09mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|