ChemNet > CAS > 61277-90-5 (2R)-( )-엔도-노르보르네올
61277-90-5 (2R)-( )-엔도-노르보르네올
상품명칭 |
(2R)-( )-엔도-노르보르네올 |
별명 |
;(1S, 2R, 4R) - Bicyclo [2.2.1] 헵탄 2- 올; ( )-엔도-2-노르보르네올; (1S, 2R, 4R)-( )-엔도-노르보르네올 |
영문 이름 |
(2R)-(+)-endo-Norborneol; (1S,2R,4R)-Bicyclo[2.2.1]heptan-2-ol; (+)-endo-2-Norborneol; (1S,2R,4R)-(+)-endo-Norborneol |
분자식 |
C7H12O |
분자량 |
112.1696 |
InChI |
InChI=1/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m1/s1 |
cas번호 |
61277-90-5 |
분자 구조 |
|
밀도 |
1.098g/cm3 |
녹는 점 |
149-154℃ |
비등점 |
176.499°C at 760 mmHg |
굴절 지수 |
1.537 |
인화점 |
74.376°C |
증기압 |
0.332mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|