613-62-7 BENZYL-2-NAPHTHYLETHER
상품명칭 |
BENZYL-2-NAPHTHYLETHER |
영문 이름 |
BENZYL-2-NAPHTHYLETHER; BETA-NAPHTHYLBENZYLETHER (BON); 2-(phenylmethoxy)naphthalene; nbe; NIPAFAX BNE SENSLON-50; 2-(benzyloxy)naphthalene; 2-Benzyloxynaphthalene; 2-(Phenylmethoxy)-Naphthalene |
분자식 |
C17H14O |
분자량 |
234.2925 |
InChI |
InChI=1/C17H14O/c1-2-6-14(7-3-1)13-18-17-11-10-15-8-4-5-9-16(15)12-17/h1-12H,13H2 |
cas번호 |
613-62-7 |
EC번호 |
405-490-3 |
분자 구조 |
|
밀도 |
1.125g/cm3 |
비등점 |
388.1°C at 760 mmHg |
굴절 지수 |
1.642 |
인화점 |
156.4°C |
증기압 |
7.02E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R53:May cause long-term adverse effects in the aquatic environment.;
|
보안 규칙 |
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|