ChemNet > CAS > 61341-26-2 3-Methylthiophene-2-carbonyl chloride
61341-26-2 3-Methylthiophene-2-carbonyl chloride
| 상품명칭 |
3-Methylthiophene-2-carbonyl chloride |
| 영문 이름 |
3-Methylthiophene-2-carbonyl chloride; 2-thiophenecarbonyl chloride, 3-methyl-; 3-METHYLTHIOPHENE-2-CARBONYL CHLORIDE |
| 분자식 |
C6H5ClOS |
| 분자량 |
160.6213 |
| InChI |
InChI=1/C6H5ClOS/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3 |
| cas번호 |
61341-26-2 |
| 분자 구조 |
|
| 밀도 |
1.32g/cm3 |
| 비등점 |
219.9°C at 760 mmHg |
| 굴절 지수 |
1.566 |
| 인화점 |
86.8°C |
| 증기압 |
0.116mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
