6135-31-5 메틸 N- 에틸 카르 바 메이트
상품명칭 |
메틸 N- 에틸 카르 바 메이트 |
별명 |
; N-에틸카르밤산 메틸 에스테르; 메틸 에틸 카르바 메이트 |
영문 이름 |
Methyl N-ethylcarbamate; N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
분자식 |
C4H9NO2 |
분자량 |
103.1198 |
InChI |
InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
cas번호 |
6135-31-5 |
분자 구조 |
|
밀도 |
0.964g/cm3 |
비등점 |
172°C at 760 mmHg |
굴절 지수 |
1.4 |
인화점 |
57.8°C |
증기압 |
1.36mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|