6138-90-5 Geranyl Bromide
상품명칭 |
Geranyl Bromide |
영문 이름 |
Geranyl Bromide; 3,7-Dimethyl-2,6-octadienyl bromide; 3,7-Dimethyl-2,6-octadienyl bromide; (2E)-1-bromo-3,7-dimethylocta-2,6-diene |
분자식 |
C10H17Br |
분자량 |
217.146 |
InChI |
InChI=1/C10H17Br/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,4,6,8H2,1-3H3/b10-7+ |
cas번호 |
6138-90-5 |
EC번호 |
228-123-7 |
분자 구조 |
|
밀도 |
1.121g/cm3 |
비등점 |
227.7°C at 760 mmHg |
굴절 지수 |
1.489 |
인화점 |
95°C |
증기압 |
0.115mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|