ChemNet > CAS > 614-83-5 2-Bromo-4-methylacetanilide
614-83-5 2-Bromo-4-methylacetanilide
상품명칭 |
2-Bromo-4-methylacetanilide |
영문 이름 |
2-Bromo-4-methylacetanilide; 2-Bromo-4-methylactanilide; N-(2-bromo-4-methylphenyl)acetamide |
분자식 |
C9H10BrNO |
분자량 |
228.0858 |
InChI |
InChI=1/C9H10BrNO/c1-6-3-4-9(8(10)5-6)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
cas번호 |
614-83-5 |
분자 구조 |
|
밀도 |
1.471g/cm3 |
녹는 점 |
117-119℃ |
비등점 |
349.9°C at 760 mmHg |
굴절 지수 |
1.6 |
인화점 |
165.4°C |
증기압 |
4.57E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|