ChemNet > CAS > 61471-45-2 3-(1H-pyrrol-1-yl)benzoic acid
61471-45-2 3-(1H-pyrrol-1-yl)benzoic acid
| 상품명칭 |
3-(1H-pyrrol-1-yl)benzoic acid |
| 영문 이름 |
3-(1H-pyrrol-1-yl)benzoic acid;3-(1H-pyrrol-1-yl)benzoate |
| 분자식 |
C11H8NO2 |
| 분자량 |
186.1873 |
| InChI |
InChI=1/C11H9NO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h1-8H,(H,13,14)/p-1 |
| cas번호 |
61471-45-2 |
| 분자 구조 |
|
| 녹는 점 |
268℃ |
| 비등점 |
376.6°C at 760 mmHg |
| 인화점 |
181.6°C |
| 증기압 |
2.43E-06mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
