ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
| 상품명칭 |
2,5-Dihydroxy-1,4-benzoquinone |
| 영문 이름 |
2,5-Dihydroxy-1,4-benzoquinone; 2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| 분자식 |
C6H4O4 |
| 분자량 |
140.0936 |
| InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
| cas번호 |
615-94-1 |
| EC번호 |
210-454-3 |
| 분자 구조 |
|
| 밀도 |
1.843g/cm3 |
| 녹는 점 |
220℃ |
| 비등점 |
322.3°C at 760 mmHg |
| 굴절 지수 |
1.729 |
| 인화점 |
162.9°C |
| 증기압 |
2.24E-05mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
