ChemNet > CAS > 617-05-0 Vanilicacidethylester; 97%
617-05-0 Vanilicacidethylester; 97%
상품명칭 |
Vanilicacidethylester; 97% |
영문 이름 |
Vanilicacidethylester; 97%; Vanilic acid ethyl ester; Ethyl vanillate; Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester; 4-Hydroxy-3-methoxybenzoic acid ethyl ester; ethyl 4-hydroxy-3-methoxybenzoate |
분자식 |
C10H12O4 |
분자량 |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
cas번호 |
617-05-0 |
EC번호 |
210-503-9 |
분자 구조 |
|
밀도 |
1.18g/cm3 |
녹는 점 |
39-41℃ |
비등점 |
292°C at 760 mmHg |
굴절 지수 |
1.528 |
인화점 |
122.4°C |
증기압 |
0.00108mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|