617-36-7 Ethyl oxamate
상품명칭 |
Ethyl oxamate |
영문 이름 |
Ethyl oxamate; oxamethane; Oxamic acid ethyl ester; ethyl amino(oxo)acetate |
분자식 |
C4H7NO3 |
분자량 |
117.1033 |
InChI |
InChI=1/C4H7NO3/c1-2-8-4(7)3(5)6/h2H2,1H3,(H2,5,6) |
cas번호 |
617-36-7 |
EC번호 |
210-512-8 |
분자 구조 |
|
밀도 |
1.184g/cm3 |
녹는 점 |
112-115℃ |
비등점 |
188.7°C at 760 mmHg |
굴절 지수 |
1.437 |
인화점 |
87°C |
증기압 |
0.59mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|