618-32-6 Benzoyl bromide
상품명칭 |
Benzoyl bromide |
영문 이름 |
Benzoyl bromide; |
분자식 |
C7H5BrO |
분자량 |
185.018 |
InChI |
InChI=1/C7H5BrO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
cas번호 |
618-32-6 |
EC번호 |
210-544-2 |
분자 구조 |
|
밀도 |
1.572g/cm3 |
녹는 점 |
-24℃ |
비등점 |
218.5°C at 760 mmHg |
굴절 지수 |
1.584 |
인화점 |
89.7°C |
증기압 |
0.125mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S25:Avoid contact with eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|