ChemNet > CAS > 6214-44-4 4-Ethoxybenzyl alcohol
6214-44-4 4-Ethoxybenzyl alcohol
| 상품명칭 |
4-Ethoxybenzyl alcohol |
| 영문 이름 |
4-Ethoxybenzyl alcohol; AI3-05517; Benzenemethanol, 4-ethoxy-; (4-ethoxyphenyl)methanol |
| 분자식 |
C9H12O2 |
| 분자량 |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3 |
| cas번호 |
6214-44-4 |
| EC번호 |
228-283-8 |
| 분자 구조 |
|
| 밀도 |
1.058g/cm3 |
| 녹는 점 |
27-32℃ |
| 비등점 |
273°C at 760 mmHg |
| 굴절 지수 |
1.524 |
| 인화점 |
114.4°C |
| 증기압 |
0.00287mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
