623-51-8 Ethyl 2-mercaptoacetate
상품명칭 |
Ethyl 2-mercaptoacetate |
영문 이름 |
Ethyl 2-mercaptoacetate; Ethyl thioglycolate; Mercaptoacetic acid ethyl ester; Ethyl mercaptoacetate; Ethyl Thioglycollate; 2-Mercapto-acetic acid ethyl ester; ethyl sulfanylacetate |
분자식 |
C4H8O2S |
분자량 |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-2-6-4(5)3-7/h7H,2-3H2,1H3 |
cas번호 |
623-51-8 |
EC번호 |
210-800-3 |
분자 구조 |
|
밀도 |
1.072g/cm3 |
비등점 |
157.8°C at 760 mmHg |
굴절 지수 |
1.452 |
인화점 |
47.8°C |
증기압 |
2.7mmHg at 25°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R10:Flammable.;
R25:Toxic if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|