ChemNet > CAS > 62306-79-0 5-Methylfuran-2-boronic acid
62306-79-0 5-Methylfuran-2-boronic acid
상품명칭 |
5-Methylfuran-2-boronic acid |
영문 이름 |
5-Methylfuran-2-boronic acid; (5-Methyl-2-furanyl)-boronic acid; 5-Methylfuryl-2-boronic acid; (5-methyl-2-furyl)boronic acid |
분자식 |
C5H7BO3 |
분자량 |
125.9183 |
InChI |
InChI=1/C5H7BO3/c1-4-2-3-5(9-4)6(7)8/h2-3,7-8H,1H3 |
cas번호 |
62306-79-0 |
분자 구조 |
|
밀도 |
1.197g/cm3 |
비등점 |
264.365°C at 760 mmHg |
굴절 지수 |
1.489 |
인화점 |
113.684°C |
증기압 |
0.005mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|