ChemNet > CAS > 62348-13-4 Isoxazole-5-carbonyl chloride
62348-13-4 Isoxazole-5-carbonyl chloride
상품명칭 |
Isoxazole-5-carbonyl chloride |
영문 이름 |
Isoxazole-5-carbonyl chloride; 5-Isoxazolecarboxylic acid chloride; Isoxazole-5-carbonychlordie |
분자식 |
C4H2ClNO2 |
분자량 |
131.5172 |
InChI |
InChI=1/C4H2ClNO2/c5-4(7)3-1-2-6-8-3/h1-2H |
cas번호 |
62348-13-4 |
분자 구조 |
|
밀도 |
1.432g/cm3 |
비등점 |
213.213°C at 760 mmHg |
굴절 지수 |
1.497 |
인화점 |
82.749°C |
증기압 |
0.166mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|