624-39-5 1,4-Benzenedithiol
상품명칭 |
1,4-Benzenedithiol |
영문 이름 |
1,4-Benzenedithiol; 1,4-Dimercaptobenzene; Dithiohydroquinone; benzene-1,4-dithiol; benzene-1,4-bis(thiolate) |
분자식 |
C6H4S2 |
분자량 |
140.2271 |
InChI |
InChI=1/C6H6S2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/p-2 |
cas번호 |
624-39-5 |
분자 구조 |
|
비등점 |
243.3°C at 760 mmHg |
인화점 |
111.8°C |
증기압 |
0.0506mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|