ChemNet > CAS > 625-33-2 3-penten-2-one
625-33-2 3-penten-2-one
| 상품명칭 |
3-penten-2-one |
| 영문 이름 |
3-penten-2-one; ethylideneacetone; pent-3-en-2-one; (3E)-pent-3-en-2-one; (3Z)-pent-3-en-2-one |
| 분자식 |
C5H8O |
| 분자량 |
84.1164 |
| InChI |
InChI=1/C5H8O/c1-3-4-5(2)6/h3-4H,1-2H3/b4-3- |
| cas번호 |
625-33-2 |
| EC번호 |
210-888-3 |
| 분자 구조 |
|
| 밀도 |
0.826g/cm3 |
| 비등점 |
122°C at 760 mmHg |
| 굴절 지수 |
1.411 |
| 인화점 |
19.8°C |
| 증기압 |
14.2mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R36/37:Irritating to eyes and respiratory system.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
