625-38-7 Vinylacetic acid
상품명칭 |
Vinylacetic acid |
영문 이름 |
Vinylacetic acid; 3-Butenoic acid; Vinylacetic acid, (3-Butenoic acid); but-3-enoic acid; but-3-enoate |
분자식 |
C4H5O2 |
분자량 |
85.0818 |
InChI |
InChI=1/C4H6O2/c1-2-3-4(5)6/h2H,1,3H2,(H,5,6)/p-1 |
cas번호 |
625-38-7 |
EC번호 |
210-892-5 |
분자 구조 |
|
녹는 점 |
-39℃ |
비등점 |
170.6°C at 760 mmHg |
인화점 |
68.2°C |
증기압 |
0.714mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|