ChemNet > CAS > 625-48-9 2-Nitroethanol
625-48-9 2-Nitroethanol
| 상품명칭 |
2-Nitroethanol |
| 영문 이름 |
2-Nitroethanol;1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
| 분자식 |
C2H5NO3 |
| 분자량 |
91.07 |
| InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
| cas번호 |
625-48-9 |
| EC번호 |
210-895-1 |
| 분자 구조 |
|
| 밀도 |
1.267g/cm3 |
| 비등점 |
193.8°C at 760 mmHg |
| 굴절 지수 |
1.438 |
| 인화점 |
113.8°C |
| 증기압 |
0.12mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
