ChemNet > CAS > 6258-60-2 4-Methoxybenzyl mercaptan
6258-60-2 4-Methoxybenzyl mercaptan
| 상품명칭 |
4-Methoxybenzyl mercaptan |
| 영문 이름 |
4-Methoxybenzyl mercaptan; 4-Methoxy-alpha-toluenethiol = 4-Methoxybenzyl Mercaptan; 4-Methoxy-alpha-toluenethiol; (4-methoxyphenyl)methanethiol |
| 분자식 |
C8H10OS |
| 분자량 |
154.2294 |
| InChI |
InChI=1/C8H10OS/c1-9-8-4-2-7(6-10)3-5-8/h2-5,10H,6H2,1H3 |
| cas번호 |
6258-60-2 |
| EC번호 |
228-393-6 |
| 분자 구조 |
|
| 밀도 |
1.072g/cm3 |
| 비등점 |
294.5°C at 760 mmHg |
| 굴절 지수 |
1.549 |
| 인화점 |
103.4°C |
| 증기압 |
0.00284mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
