ChemNet > CAS > 627-04-3 (Ethylthio)acetic acid
627-04-3 (Ethylthio)acetic acid
| 상품명칭 |
(Ethylthio)acetic acid |
| 영문 이름 |
(Ethylthio)acetic acid; S-Ethylthioglycolic acid; (ethylsulfanyl)acetic acid |
| 분자식 |
C4H8O2S |
| 분자량 |
120.1701 |
| InChI |
InChI=1/C4H8O2S/c1-2-7-3-4(5)6/h2-3H2,1H3,(H,5,6) |
| cas번호 |
627-04-3 |
| EC번호 |
210-979-8 |
| 분자 구조 |
|
| 밀도 |
1.164g/cm3 |
| 비등점 |
229°C at 760 mmHg |
| 굴절 지수 |
1.496 |
| 인화점 |
92.3°C |
| 증기압 |
0.0254mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
