ChemNet > CAS > 627-09-8 Propargylacetate(Aceticacidpropargylester)
627-09-8 Propargylacetate(Aceticacidpropargylester)
상품명칭 |
Propargylacetate(Aceticacidpropargylester) |
영문 이름 |
Propargylacetate(Aceticacidpropargylester); Propargyl acetate (Acetic acid propargyl ester); Propargyl acetate; Acetic acid propargyl ester~2-Propyn-1-yl acetate; prop-2-ynyl acetate |
분자식 |
C5H6O2 |
분자량 |
98.0999 |
InChI |
InChI=1/C5H6O2/c1-3-4-7-5(2)6/h1H,4H2,2H3 |
cas번호 |
627-09-8 |
분자 구조 |
|
밀도 |
0.997g/cm3 |
비등점 |
122.4°C at 760 mmHg |
굴절 지수 |
1.418 |
인화점 |
28.3°C |
증기압 |
14mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|