627-90-7 ethyl undecanoate
상품명칭 |
ethyl undecanoate |
영문 이름 |
ethyl undecanoate; Undecanoic acid ethyl ester; Undecanoic acid-ethyl ester |
분자식 |
C13H26O2 |
분자량 |
214.3443 |
InChI |
InChI=1/C13H26O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h3-12H2,1-2H3 |
cas번호 |
627-90-7 |
EC번호 |
211-018-5 |
분자 구조 |
|
밀도 |
0.869g/cm3 |
녹는 점 |
-15℃ |
비등점 |
258.4°C at 760 mmHg |
굴절 지수 |
1.432 |
인화점 |
109.5°C |
증기압 |
0.0137mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|